C13H24N4OS — CID 91642666
N-(3,3-dimethylbutan-2-yl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 91642666) has the molecular formula C13H24N4OS and a molecular weight of 284.43 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 91642666 |
| Molecular Formula | C13H24N4OS |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)NC(C)C(C)(C)C |
| InChI | InChI=1S/C13H24N4OS/c1-6-7-10-15-16-12(19)17(10)8-11(18)14-9(2)13(3,4)5/h9H,6-8H2,1-5H3,(H,14,18)(H,16,19) |
| InChIKey | JLQMUAMVVCOVCI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|