About N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride
N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride (PubChem CID 91642718) has the molecular formula C10H15ClN2O2S
and a molecular weight of 262.76 g/mol. Its IUPAC name is N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride |
| PubChem CID | 91642718 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)CNC2.Cl |
| InChI | InChI=1S/C10H14N2O2S.ClH/c1-12(2)15(13,14)10-4-3-8-6-11-7-9(8)5-10;/h3-5,11H,6-7H2,1-2H3;1H |
| InChIKey | MLDKVKSVTFNGGM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride?
The IUPAC name of N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride (CID 91642718) is N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride.
What is the SMILES notation for N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride?
The canonical SMILES for N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride is CN(C)S(=O)(=O)c1ccc2c(c1)CNC2.Cl.
What is the InChIKey of N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride?
The InChIKey is MLDKVKSVTFNGGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S.ClH/c1-12(2)15(13,14)10-4-3-8-6-11-7-9(8)5-10;/h3-5,11H,6-7H2,1-2H3;1H.
What are the key properties of N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride?
N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride has a molecular weight of 262.76 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2,3-dihydro-1H-isoindole-5-sulfonamide;hydrochloride is sourced from PubChem (CID 91642718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).