About 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride
2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride (PubChem CID 91642775) has the molecular formula C8H18Cl2N2
and a molecular weight of 213.15 g/mol. Its IUPAC name is 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride |
| PubChem CID | 91642775 |
| Molecular Formula | C8H18Cl2N2 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride |
| SMILES | CC1=CCN(CCN)CC1.Cl.Cl |
| InChI | InChI=1S/C8H16N2.2ClH/c1-8-2-5-10(6-3-8)7-4-9;;/h2H,3-7,9H2,1H3;2*1H |
| InChIKey | MGHRUIDATFDBFJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride?
The IUPAC name of 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride (CID 91642775) is 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride.
What is the SMILES notation for 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride?
The canonical SMILES for 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride is CC1=CCN(CCN)CC1.Cl.Cl.
What is the InChIKey of 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride?
The InChIKey is MGHRUIDATFDBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.2ClH/c1-8-2-5-10(6-3-8)7-4-9;;/h2H,3-7,9H2,1H3;2*1H.
What are the key properties of 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride?
2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride has a molecular weight of 213.15 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanamine;dihydrochloride is sourced from PubChem (CID 91642775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).