About 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol
8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 91643070) has the molecular formula C15H15F2N3O
and a molecular weight of 291.30 g/mol. Its IUPAC name is 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 91643070 |
| Molecular Formula | C15H15F2N3O |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1CC2CCC(C1)N2c1cnc2cc(F)c(F)cc2n1 |
| InChI | InChI=1S/C15H15F2N3O/c16-11-5-13-14(6-12(11)17)19-15(7-18-13)20-8-1-2-9(20)4-10(21)3-8/h5-10,21H,1-4H2 |
| InChIKey | NWTZVRNBTGJMHA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol (CID 91643070) is 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol is OC1CC2CCC(C1)N2c1cnc2cc(F)c(F)cc2n1.
What is the InChIKey of 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol?
The InChIKey is NWTZVRNBTGJMHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2N3O/c16-11-5-13-14(6-12(11)17)19-15(7-18-13)20-8-1-2-9(20)4-10(21)3-8/h5-10,21H,1-4H2.
What are the key properties of 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol?
8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol has a molecular weight of 291.30 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(6,7-difluoroquinoxalin-2-yl)-8-azabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 91643070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).