About N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide
N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 91643251) has the molecular formula C14H29NO2S
and a molecular weight of 275.46 g/mol. Its IUPAC name is N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide |
| PubChem CID | 91643251 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CCC1CCCC(NS(=O)(=O)CCC(C)(C)C)C1 |
| InChI | InChI=1S/C14H29NO2S/c1-5-12-7-6-8-13(11-12)15-18(16,17)10-9-14(2,3)4/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | ZRIYEVHBEQEMPV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide?
The IUPAC name of N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide (CID 91643251) is N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide.
What is the SMILES notation for N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide?
The canonical SMILES for N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide is CCC1CCCC(NS(=O)(=O)CCC(C)(C)C)C1.
What is the InChIKey of N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide?
The InChIKey is ZRIYEVHBEQEMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2S/c1-5-12-7-6-8-13(11-12)15-18(16,17)10-9-14(2,3)4/h12-13,15H,5-11H2,1-4H3.
What are the key properties of N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide?
N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide has a molecular weight of 275.46 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethylcyclohexyl)-3,3-dimethylbutane-1-sulfonamide is sourced from PubChem (CID 91643251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).