About N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine
N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine (PubChem CID 91643804) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine |
| PubChem CID | 91643804 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine |
| SMILES | CC#CCN(C)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H17NO2S/c1-3-4-7-11(2)10-5-8-14(12,13)9-6-10/h10H,5-9H2,1-2H3 |
| InChIKey | PFUSCIQPWKGDKP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine?
The IUPAC name of N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine (CID 91643804) is N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine.
What is the SMILES notation for N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine?
The canonical SMILES for N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine is CC#CCN(C)C1CCS(=O)(=O)CC1.
What is the InChIKey of N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine?
The InChIKey is PFUSCIQPWKGDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S/c1-3-4-7-11(2)10-5-8-14(12,13)9-6-10/h10H,5-9H2,1-2H3.
What are the key properties of N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine?
N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine has a molecular weight of 215.32 g/mol, XLogP of 0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-2-ynyl-N-methyl-1,1-dioxothian-4-amine is sourced from PubChem (CID 91643804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).