C12H18N2O5S — CID 91643832
2-cyclohexyloxy-N-(1,2-oxazol-3-ylmethylsulfonyl)acetamide (PubChem CID 91643832) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-cyclohexyloxy-N-(1,2-oxazol-3-ylmethylsulfonyl)acetamide.
| Compound Name | 2-cyclohexyloxy-N-(1,2-oxazol-3-ylmethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 91643832 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-cyclohexyloxy-N-(1,2-oxazol-3-ylmethylsulfonyl)acetamide |
| SMILES | O=C(COC1CCCCC1)NS(=O)(=O)Cc1ccon1 |
| InChI | InChI=1S/C12H18N2O5S/c15-12(8-18-11-4-2-1-3-5-11)14-20(16,17)9-10-6-7-19-13-10/h6-7,11H,1-5,8-9H2,(H,14,15) |
| InChIKey | ZJWYBWSDTDPOBA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |