C20H25N3O2S — CID 91643899
3-(6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl)-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)urea (PubChem CID 91643899) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 3-(6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl)-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)urea.
| Compound Name | 3-(6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl)-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 91643899 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3-(6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl)-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)urea |
| SMILES | Cc1ccc2c(c1C)OCC2NC(=O)N(C)Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C20H25N3O2S/c1-12-8-9-14-16(11-25-19(14)13(12)2)22-20(24)23(3)10-18-21-15-6-4-5-7-17(15)26-18/h8-9,16H,4-7,10-11H2,1-3H3,(H,22,24) |
| InChIKey | UBWBUUNDXXPLPV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |