C13H14Cl4N4O — CID 91644544
1,3-bis[(4,5-dichloro-1-methylpyrrol-2-yl)methyl]urea (PubChem CID 91644544) has the molecular formula C13H14Cl4N4O and a molecular weight of 384.09 g/mol. Its IUPAC name is 1,3-bis[(4,5-dichloro-1-methylpyrrol-2-yl)methyl]urea.
| Compound Name | 1,3-bis[(4,5-dichloro-1-methylpyrrol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 91644544 |
| Molecular Formula | C13H14Cl4N4O |
| Molecular Weight | 384.09 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 1,3-bis[(4,5-dichloro-1-methylpyrrol-2-yl)methyl]urea |
| SMILES | Cn1c(CNC(=O)NCc2cc(Cl)c(Cl)n2C)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl4N4O/c1-20-7(3-9(14)11(20)16)5-18-13(22)19-6-8-4-10(15)12(17)21(8)2/h3-4H,5-6H2,1-2H3,(H2,18,19,22) |
| InChIKey | JECHZTKQXAERBB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.09 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |