C14H21ClN2OS — CID 91645523
(2S)-N-[(4-methylsulfanylphenyl)methyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 91645523) has the molecular formula C14H21ClN2OS and a molecular weight of 300.85 g/mol. Its IUPAC name is (2S)-N-[(4-methylsulfanylphenyl)methyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-[(4-methylsulfanylphenyl)methyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 91645523 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2S)-N-[(4-methylsulfanylphenyl)methyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | CSc1ccc(CNC(=O)[C@@H]2CCCCN2)cc1.Cl |
| InChI | InChI=1S/C14H20N2OS.ClH/c1-18-12-7-5-11(6-8-12)10-16-14(17)13-4-2-3-9-15-13;/h5-8,13,15H,2-4,9-10H2,1H3,(H,16,17);1H/t13-;/m0./s1 |
| InChIKey | LZCJTSJTKSHWMA-ZOWNYOTGSA-N |
| XLogP | 2.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |