About N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide
N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide (PubChem CID 91645687) has the molecular formula C19H29N5O
and a molecular weight of 343.48 g/mol. Its IUPAC name is N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide |
| PubChem CID | 91645687 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide |
| SMILES | Cn1nc(CC(C)(C)C)cc1NC(=O)c1cccn1C1CCNCC1 |
| InChI | InChI=1S/C19H29N5O/c1-19(2,3)13-14-12-17(23(4)22-14)21-18(25)16-6-5-11-24(16)15-7-9-20-10-8-15/h5-6,11-12,15,20H,7-10,13H2,1-4H3,(H,21,25) |
| InChIKey | YUIDTTYQNJYUNW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide?
The IUPAC name of N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide (CID 91645687) is N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide.
What is the SMILES notation for N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide?
The canonical SMILES for N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide is Cn1nc(CC(C)(C)C)cc1NC(=O)c1cccn1C1CCNCC1.
What is the InChIKey of N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide?
The InChIKey is YUIDTTYQNJYUNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N5O/c1-19(2,3)13-14-12-17(23(4)22-14)21-18(25)16-6-5-11-24(16)15-7-9-20-10-8-15/h5-6,11-12,15,20H,7-10,13H2,1-4H3,(H,21,25).
What are the key properties of N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide?
N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide has a molecular weight of 343.48 g/mol, XLogP of 2.99, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,2-dimethylpropyl)-1-methylpyrazol-5-yl]-1-piperidin-4-ylpyrrole-2-carboxamide is sourced from PubChem (CID 91645687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).