About 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol
4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol (PubChem CID 91645935) has the molecular formula C12H17F6NO2
and a molecular weight of 321.26 g/mol. Its IUPAC name is 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol |
| PubChem CID | 91645935 |
| Molecular Formula | C12H17F6NO2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol |
| SMILES | OC1(CN2CCC(C(F)(F)F)(C(F)(F)F)C2)CCOCC1 |
| InChI | InChI=1S/C12H17F6NO2/c13-11(14,15)10(12(16,17)18)1-4-19(8-10)7-9(20)2-5-21-6-3-9/h20H,1-8H2 |
| InChIKey | KCXFKIXCXXIBDV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol?
The IUPAC name of 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol (CID 91645935) is 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol?
The canonical SMILES for 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol is OC1(CN2CCC(C(F)(F)F)(C(F)(F)F)C2)CCOCC1.
What is the InChIKey of 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol?
The InChIKey is KCXFKIXCXXIBDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F6NO2/c13-11(14,15)10(12(16,17)18)1-4-19(8-10)7-9(20)2-5-21-6-3-9/h20H,1-8H2.
What are the key properties of 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol?
4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol has a molecular weight of 321.26 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]methyl]oxan-4-ol is sourced from PubChem (CID 91645935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).