About N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide
N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide (PubChem CID 91645938) has the molecular formula C15H19N5O2S
and a molecular weight of 333.42 g/mol. Its IUPAC name is N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide.
Molecular Properties
| Compound Name | N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide |
| PubChem CID | 91645938 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide |
| SMILES | CCc1ncc(NC(=O)C(=O)NC(C)c2ncc(CC)s2)cn1 |
| InChI | InChI=1S/C15H19N5O2S/c1-4-11-8-18-15(23-11)9(3)19-13(21)14(22)20-10-6-16-12(5-2)17-7-10/h6-9H,4-5H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | QIERRZIEEMYCCH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide?
The IUPAC name of N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide (CID 91645938) is N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide.
What is the SMILES notation for N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide?
The canonical SMILES for N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide is CCc1ncc(NC(=O)C(=O)NC(C)c2ncc(CC)s2)cn1.
What is the InChIKey of N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide?
The InChIKey is QIERRZIEEMYCCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O2S/c1-4-11-8-18-15(23-11)9(3)19-13(21)14(22)20-10-6-16-12(5-2)17-7-10/h6-9H,4-5H2,1-3H3,(H,19,21)(H,20,22).
What are the key properties of N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide?
N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide has a molecular weight of 333.42 g/mol, XLogP of 1.87, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethylpyrimidin-5-yl)-N'-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]oxamide is sourced from PubChem (CID 91645938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).