C16H19N5O2S — CID 91646788
1-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-(1,3-dihydro-2-benzofuran-5-yl)urea (PubChem CID 91646788) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-(1,3-dihydro-2-benzofuran-5-yl)urea.
| Compound Name | 1-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-(1,3-dihydro-2-benzofuran-5-yl)urea |
|---|---|
| PubChem CID | 91646788 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-(1,3-dihydro-2-benzofuran-5-yl)urea |
| SMILES | O=C(NCCn1c(C2CC2)n[nH]c1=S)Nc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C16H19N5O2S/c22-15(18-13-4-3-11-8-23-9-12(11)7-13)17-5-6-21-14(10-1-2-10)19-20-16(21)24/h3-4,7,10H,1-2,5-6,8-9H2,(H,20,24)(H2,17,18,22) |
| InChIKey | GATIXQALGQMCLR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|