C18H18ClNOS2 — CID 9164695
N-[(1R)-1-(3-chlorophenyl)ethyl]-4-(1,3-dithiolan-2-yl)benzamide (PubChem CID 9164695) has the molecular formula C18H18ClNOS2 and a molecular weight of 363.94 g/mol. Its IUPAC name is N-[(1R)-1-(3-chlorophenyl)ethyl]-4-(1,3-dithiolan-2-yl)benzamide.
| Compound Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-4-(1,3-dithiolan-2-yl)benzamide |
|---|---|
| PubChem CID | 9164695 |
| Molecular Formula | C18H18ClNOS2 |
| Molecular Weight | 363.94 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-4-(1,3-dithiolan-2-yl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(C2SCCS2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H18ClNOS2/c1-12(15-3-2-4-16(19)11-15)20-17(21)13-5-7-14(8-6-13)18-22-9-10-23-18/h2-8,11-12,18H,9-10H2,1H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | MOVOTXFXPAQZQX-GFCCVEGCSA-N |
| XLogP | 5.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.94 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |