About (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol
(1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol (PubChem CID 91647488) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 91647488 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC(C)[C@@H]1C[C@@H](O)c2ccccc21 |
| InChI | InChI=1S/C12H16O/c1-8(2)11-7-12(13)10-6-4-3-5-9(10)11/h3-6,8,11-13H,7H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | UAUSFZLVYDLYSY-NWDGAFQWSA-N |
| XLogP | 2.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol (CID 91647488) is (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol is CC(C)[C@@H]1C[C@@H](O)c2ccccc21.
What is the InChIKey of (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is UAUSFZLVYDLYSY-NWDGAFQWSA-N. The full InChI is InChI=1S/C12H16O/c1-8(2)11-7-12(13)10-6-4-3-5-9(10)11/h3-6,8,11-13H,7H2,1-2H3/t11-,12+/m0/s1.
What are the key properties of (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol?
(1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 176.26 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3S)-3-propan-2-yl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 91647488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).