C6H10Cl2F2N4 — CID 91647570
3-(difluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;dihydrochloride (PubChem CID 91647570) has the molecular formula C6H10Cl2F2N4 and a molecular weight of 247.08 g/mol. Its IUPAC name is 3-(difluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;dihydrochloride.
| Compound Name | 3-(difluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;dihydrochloride |
|---|---|
| PubChem CID | 91647570 |
| Molecular Formula | C6H10Cl2F2N4 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 3-(difluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)c1nnc2n1CCNC2 |
| InChI | InChI=1S/C6H8F2N4.2ClH/c7-5(8)6-11-10-4-3-9-1-2-12(4)6;;/h5,9H,1-3H2;2*1H |
| InChIKey | PTPDODCKENBEPW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |