About 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide
6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide (PubChem CID 91647573) has the molecular formula C11H15Br2N
and a molecular weight of 321.06 g/mol. Its IUPAC name is 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide.
Molecular Properties
| Compound Name | 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide |
| PubChem CID | 91647573 |
| Molecular Formula | C11H15Br2N |
| Molecular Weight | 321.06 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide |
| SMILES | Br.CN1CCCc2cc(CBr)ccc21 |
| InChI | InChI=1S/C11H14BrN.BrH/c1-13-6-2-3-10-7-9(8-12)4-5-11(10)13;/h4-5,7H,2-3,6,8H2,1H3;1H |
| InChIKey | FOSJHMSUIKPLQQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.06 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide?
The IUPAC name of 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide (CID 91647573) is 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide.
What is the SMILES notation for 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide?
The canonical SMILES for 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide is Br.CN1CCCc2cc(CBr)ccc21.
What is the InChIKey of 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide?
The InChIKey is FOSJHMSUIKPLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrN.BrH/c1-13-6-2-3-10-7-9(8-12)4-5-11(10)13;/h4-5,7H,2-3,6,8H2,1H3;1H.
What are the key properties of 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide?
6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide has a molecular weight of 321.06 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(bromomethyl)-1-methyl-3,4-dihydro-2H-quinoline;hydrobromide is sourced from PubChem (CID 91647573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).