About 2-propyl-1,3-oxazole-4-carbonitrile
2-propyl-1,3-oxazole-4-carbonitrile (PubChem CID 91647696) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 2-propyl-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-propyl-1,3-oxazole-4-carbonitrile |
| PubChem CID | 91647696 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 2-propyl-1,3-oxazole-4-carbonitrile |
| SMILES | CCCc1nc(C#N)co1 |
| InChI | InChI=1S/C7H8N2O/c1-2-3-7-9-6(4-8)5-10-7/h5H,2-3H2,1H3 |
| InChIKey | CRJQNFHYXCSHEW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2-propyl-1,3-oxazole-4-carbonitrile (CID 91647696) is 2-propyl-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2-propyl-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2-propyl-1,3-oxazole-4-carbonitrile is CCCc1nc(C#N)co1.
What is the InChIKey of 2-propyl-1,3-oxazole-4-carbonitrile?
The InChIKey is CRJQNFHYXCSHEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c1-2-3-7-9-6(4-8)5-10-7/h5H,2-3H2,1H3.
What are the key properties of 2-propyl-1,3-oxazole-4-carbonitrile?
2-propyl-1,3-oxazole-4-carbonitrile has a molecular weight of 136.15 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 91647696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).