About sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate
sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate (PubChem CID 91647796) has the molecular formula C10H8N3NaO2
and a molecular weight of 225.18 g/mol. Its IUPAC name is sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 91647796 |
| Molecular Formula | C10H8N3NaO2 |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate |
| SMILES | Cn1nc(-c2ccccc2)nc1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H9N3O2.Na/c1-13-9(10(14)15)11-8(12-13)7-5-3-2-4-6-7;/h2-6H,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | MZDGEPUYPLILQO-UHFFFAOYSA-M |
| XLogP | -3.15 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate?
The IUPAC name of sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate (CID 91647796) is sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate is Cn1nc(-c2ccccc2)nc1C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate?
The InChIKey is MZDGEPUYPLILQO-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9N3O2.Na/c1-13-9(10(14)15)11-8(12-13)7-5-3-2-4-6-7;/h2-6H,1H3,(H,14,15);/q;+1/p-1.
What are the key properties of sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate?
sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate has a molecular weight of 225.18 g/mol, XLogP of -3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methyl-5-phenyl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 91647796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).