C14H26N4O — CID 91648164
2-[[(cyclopent-3-en-1-ylamino)-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 91648164) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[[(cyclopent-3-en-1-ylamino)-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclopent-3-en-1-ylamino)-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 91648164 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2-[[(cyclopent-3-en-1-ylamino)-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CC(C)CN/C(=N\CC(=O)N(C)C)NC1CC=CC1 |
| InChI | InChI=1S/C14H26N4O/c1-11(2)9-15-14(16-10-13(19)18(3)4)17-12-7-5-6-8-12/h5-6,11-12H,7-10H2,1-4H3,(H2,15,16,17) |
| InChIKey | DLXPMHZVVXCCJB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|