About 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol
1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol (PubChem CID 91648261) has the molecular formula C18H24N4O
and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol |
| PubChem CID | 91648261 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol |
| SMILES | Cc1cnc(C)c(NCC2CC(O)CN2Cc2ccccc2)n1 |
| InChI | InChI=1S/C18H24N4O/c1-13-9-19-14(2)18(21-13)20-10-16-8-17(23)12-22(16)11-15-6-4-3-5-7-15/h3-7,9,16-17,23H,8,10-12H2,1-2H3,(H,20,21) |
| InChIKey | DHOAHUWXOUVFKW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol?
The IUPAC name of 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol (CID 91648261) is 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol.
What is the SMILES notation for 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol?
The canonical SMILES for 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol is Cc1cnc(C)c(NCC2CC(O)CN2Cc2ccccc2)n1.
What is the InChIKey of 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol?
The InChIKey is DHOAHUWXOUVFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O/c1-13-9-19-14(2)18(21-13)20-10-16-8-17(23)12-22(16)11-15-6-4-3-5-7-15/h3-7,9,16-17,23H,8,10-12H2,1-2H3,(H,20,21).
What are the key properties of 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol?
1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol has a molecular weight of 312.42 g/mol, XLogP of 2.14, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-[[(3,6-dimethylpyrazin-2-yl)amino]methyl]pyrrolidin-3-ol is sourced from PubChem (CID 91648261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).