C19H19N5O6 — CID 91648292
5-methoxy-4-(methoxymethoxy)-2-nitro-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]benzamide (PubChem CID 91648292) has the molecular formula C19H19N5O6 and a molecular weight of 413.39 g/mol. Its IUPAC name is 5-methoxy-4-(methoxymethoxy)-2-nitro-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]benzamide.
| Compound Name | 5-methoxy-4-(methoxymethoxy)-2-nitro-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 91648292 |
| Molecular Formula | C19H19N5O6 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 5-methoxy-4-(methoxymethoxy)-2-nitro-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]benzamide |
| SMILES | COCOc1cc([N+](=O)[O-])c(C(=O)NCc2cccnc2-n2cccn2)cc1OC |
| InChI | InChI=1S/C19H19N5O6/c1-28-12-30-17-10-15(24(26)27)14(9-16(17)29-2)19(25)21-11-13-5-3-6-20-18(13)23-8-4-7-22-23/h3-10H,11-12H2,1-2H3,(H,21,25) |
| InChIKey | VNIDHUXNQHAECE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|