About N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide
N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide (PubChem CID 91648321) has the molecular formula C12H18F6N2O
and a molecular weight of 320.28 g/mol. Its IUPAC name is N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide |
| PubChem CID | 91648321 |
| Molecular Formula | C12H18F6N2O |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide |
| SMILES | CCN(C(=O)N1CCC(C(F)(F)F)(C(F)(F)F)C1)C(C)C |
| InChI | InChI=1S/C12H18F6N2O/c1-4-20(8(2)3)9(21)19-6-5-10(7-19,11(13,14)15)12(16,17)18/h8H,4-7H2,1-3H3 |
| InChIKey | ULPTZVMDONTIFH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide?
The IUPAC name of N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide (CID 91648321) is N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide.
What is the SMILES notation for N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide?
The canonical SMILES for N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide is CCN(C(=O)N1CCC(C(F)(F)F)(C(F)(F)F)C1)C(C)C.
What is the InChIKey of N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide?
The InChIKey is ULPTZVMDONTIFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F6N2O/c1-4-20(8(2)3)9(21)19-6-5-10(7-19,11(13,14)15)12(16,17)18/h8H,4-7H2,1-3H3.
What are the key properties of N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide?
N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide has a molecular weight of 320.28 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propan-2-yl-3,3-bis(trifluoromethyl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 91648321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).