About methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate
methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate (PubChem CID 91648379) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate |
| PubChem CID | 91648379 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(CN2CCOc3cc(N(C)C)ccc32)c[nH]1 |
| InChI | InChI=1S/C17H21N3O3/c1-19(2)13-4-5-15-16(9-13)23-7-6-20(15)11-12-8-14(18-10-12)17(21)22-3/h4-5,8-10,18H,6-7,11H2,1-3H3 |
| InChIKey | ZODABNKPFWJDKA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate?
The IUPAC name of methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate (CID 91648379) is methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate.
What is the SMILES notation for methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate?
The canonical SMILES for methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate is COC(=O)c1cc(CN2CCOc3cc(N(C)C)ccc32)c[nH]1.
What is the InChIKey of methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate?
The InChIKey is ZODABNKPFWJDKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-19(2)13-4-5-15-16(9-13)23-7-6-20(15)11-12-8-14(18-10-12)17(21)22-3/h4-5,8-10,18H,6-7,11H2,1-3H3.
What are the key properties of methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate?
methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate has a molecular weight of 315.37 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 91648379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).