C15H19N5O4S2 — CID 91648887
1-N-(2-methyl-1,2,4-triazol-3-yl)-4-N,4-N-bis(prop-2-enyl)benzene-1,4-disulfonamide (PubChem CID 91648887) has the molecular formula C15H19N5O4S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-N-(2-methyl-1,2,4-triazol-3-yl)-4-N,4-N-bis(prop-2-enyl)benzene-1,4-disulfonamide.
| Compound Name | 1-N-(2-methyl-1,2,4-triazol-3-yl)-4-N,4-N-bis(prop-2-enyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 91648887 |
| Molecular Formula | C15H19N5O4S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-N-(2-methyl-1,2,4-triazol-3-yl)-4-N,4-N-bis(prop-2-enyl)benzene-1,4-disulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(S(=O)(=O)Nc2ncnn2C)cc1 |
| InChI | InChI=1S/C15H19N5O4S2/c1-4-10-20(11-5-2)26(23,24)14-8-6-13(7-9-14)25(21,22)18-15-16-12-17-19(15)3/h4-9,12H,1-2,10-11H2,3H3,(H,16,17,18) |
| InChIKey | TUPJUHJHGZWREX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|