C13H19NO4 — CID 91649052
(E)-N-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(5-ethylfuran-2-yl)prop-2-enamide (PubChem CID 91649052) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (E)-N-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(5-ethylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(5-ethylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 91649052 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (E)-N-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(5-ethylfuran-2-yl)prop-2-enamide |
| SMILES | CCc1ccc(/C=C/C(=O)NC(C)(CO)CO)o1 |
| InChI | InChI=1S/C13H19NO4/c1-3-10-4-5-11(18-10)6-7-12(17)14-13(2,8-15)9-16/h4-7,15-16H,3,8-9H2,1-2H3,(H,14,17)/b7-6+ |
| InChIKey | HQACTHNWNASRPL-VOTSOKGWSA-N |
| XLogP | 0.71 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|