C14H18N6O3 — CID 91649107
N-methyl-2-(2-methyl-3-nitrophenyl)-N-[2-(2H-tetrazol-5-yl)propyl]acetamide (PubChem CID 91649107) has the molecular formula C14H18N6O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is N-methyl-2-(2-methyl-3-nitrophenyl)-N-[2-(2H-tetrazol-5-yl)propyl]acetamide.
| Compound Name | N-methyl-2-(2-methyl-3-nitrophenyl)-N-[2-(2H-tetrazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 91649107 |
| Molecular Formula | C14H18N6O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-methyl-2-(2-methyl-3-nitrophenyl)-N-[2-(2H-tetrazol-5-yl)propyl]acetamide |
| SMILES | Cc1c(CC(=O)N(C)CC(C)c2nn[nH]n2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N6O3/c1-9(14-15-17-18-16-14)8-19(3)13(21)7-11-5-4-6-12(10(11)2)20(22)23/h4-6,9H,7-8H2,1-3H3,(H,15,16,17,18) |
| InChIKey | SVKYLMUZKKAKMP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|