About 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine
1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine (PubChem CID 91649177) has the molecular formula C11H12N6
and a molecular weight of 228.26 g/mol. Its IUPAC name is 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine |
| PubChem CID | 91649177 |
| Molecular Formula | C11H12N6 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine |
| SMILES | Cc1nn(C)c2ncc(Cn3ccnn3)cc12 |
| InChI | InChI=1S/C11H12N6/c1-8-10-5-9(7-17-4-3-13-15-17)6-12-11(10)16(2)14-8/h3-6H,7H2,1-2H3 |
| InChIKey | RYKRKVKHKQPXGT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine?
The IUPAC name of 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine (CID 91649177) is 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine.
What is the SMILES notation for 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine?
The canonical SMILES for 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine is Cc1nn(C)c2ncc(Cn3ccnn3)cc12.
What is the InChIKey of 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine?
The InChIKey is RYKRKVKHKQPXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N6/c1-8-10-5-9(7-17-4-3-13-15-17)6-12-11(10)16(2)14-8/h3-6H,7H2,1-2H3.
What are the key properties of 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine?
1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine has a molecular weight of 228.26 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-(triazol-1-ylmethyl)pyrazolo[5,4-b]pyridine is sourced from PubChem (CID 91649177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).