C23H30N2O2 — CID 91649679
N-[(1-benzyl-3-methylazetidin-3-yl)methyl]-2-(3-propan-2-yloxyphenyl)acetamide (PubChem CID 91649679) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(1-benzyl-3-methylazetidin-3-yl)methyl]-2-(3-propan-2-yloxyphenyl)acetamide.
| Compound Name | N-[(1-benzyl-3-methylazetidin-3-yl)methyl]-2-(3-propan-2-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 91649679 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[(1-benzyl-3-methylazetidin-3-yl)methyl]-2-(3-propan-2-yloxyphenyl)acetamide |
| SMILES | CC(C)Oc1cccc(CC(=O)NCC2(C)CN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-18(2)27-21-11-7-10-20(12-21)13-22(26)24-15-23(3)16-25(17-23)14-19-8-5-4-6-9-19/h4-12,18H,13-17H2,1-3H3,(H,24,26) |
| InChIKey | ONMPBFJYCUJNFC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |