About 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone
2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone (PubChem CID 91649876) has the molecular formula C14H16N2O3S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone |
| PubChem CID | 91649876 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cc1csc(-c2ccoc2)n1)N1CCC[C@H]1CO |
| InChI | InChI=1S/C14H16N2O3S/c17-7-12-2-1-4-16(12)13(18)6-11-9-20-14(15-11)10-3-5-19-8-10/h3,5,8-9,12,17H,1-2,4,6-7H2/t12-/m0/s1 |
| InChIKey | ZDVZWVSDJYERDX-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone?
The IUPAC name of 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone (CID 91649876) is 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone.
What is the SMILES notation for 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone?
The canonical SMILES for 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone is O=C(Cc1csc(-c2ccoc2)n1)N1CCC[C@H]1CO.
What is the InChIKey of 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone?
The InChIKey is ZDVZWVSDJYERDX-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H16N2O3S/c17-7-12-2-1-4-16(12)13(18)6-11-9-20-14(15-11)10-3-5-19-8-10/h3,5,8-9,12,17H,1-2,4,6-7H2/t12-/m0/s1.
What are the key properties of 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone?
2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone has a molecular weight of 292.36 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]ethanone is sourced from PubChem (CID 91649876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).