About 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile
1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile (PubChem CID 91649914) has the molecular formula C15H11ClN4O2
and a molecular weight of 314.73 g/mol. Its IUPAC name is 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile |
| PubChem CID | 91649914 |
| Molecular Formula | C15H11ClN4O2 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile |
| SMILES | Cc1nc(C#N)c(C#N)n1Cc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C15H11ClN4O2/c1-9-19-13(4-17)14(5-18)20(9)6-10-2-12(16)3-11-7-21-8-22-15(10)11/h2-3H,6-8H2,1H3 |
| InChIKey | BGPFMYLFMOUBGA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile?
The IUPAC name of 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile (CID 91649914) is 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile is Cc1nc(C#N)c(C#N)n1Cc1cc(Cl)cc2c1OCOC2.
What is the InChIKey of 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile?
The InChIKey is BGPFMYLFMOUBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN4O2/c1-9-19-13(4-17)14(5-18)20(9)6-10-2-12(16)3-11-7-21-8-22-15(10)11/h2-3H,6-8H2,1H3.
What are the key properties of 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile?
1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile has a molecular weight of 314.73 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-2-methylimidazole-4,5-dicarbonitrile is sourced from PubChem (CID 91649914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).