C16H17N5O2S — CID 91650250
2-phenyl-N-(3-pyrazol-1-ylpropyl)pyrimidine-5-sulfonamide (PubChem CID 91650250) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-phenyl-N-(3-pyrazol-1-ylpropyl)pyrimidine-5-sulfonamide.
| Compound Name | 2-phenyl-N-(3-pyrazol-1-ylpropyl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 91650250 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-phenyl-N-(3-pyrazol-1-ylpropyl)pyrimidine-5-sulfonamide |
| SMILES | O=S(=O)(NCCCn1cccn1)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C16H17N5O2S/c22-24(23,20-9-5-11-21-10-4-8-19-21)15-12-17-16(18-13-15)14-6-2-1-3-7-14/h1-4,6-8,10,12-13,20H,5,9,11H2 |
| InChIKey | GHMVIXIXFIVQOP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|