C15H18N8 — CID 91650469
N-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 91650469) has the molecular formula C15H18N8 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 91650469 |
| Molecular Formula | C15H18N8 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | Cc1nnc2ccc(NCc3nnc(C4CC4)n3C3CC3)nn12 |
| InChI | InChI=1S/C15H18N8/c1-9-17-18-13-7-6-12(21-23(9)13)16-8-14-19-20-15(10-2-3-10)22(14)11-4-5-11/h6-7,10-11H,2-5,8H2,1H3,(H,16,21) |
| InChIKey | QVRONODYHUQCME-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |