About 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide
5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide (PubChem CID 91650678) has the molecular formula C11H8ClN3O3S2
and a molecular weight of 329.79 g/mol. Its IUPAC name is 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide |
| PubChem CID | 91650678 |
| Molecular Formula | C11H8ClN3O3S2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide |
| SMILES | Cc1nonc1NS(=O)(=O)c1cc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H8ClN3O3S2/c1-6-11(14-18-13-6)15-20(16,17)10-5-7-4-8(12)2-3-9(7)19-10/h2-5H,1H3,(H,14,15) |
| InChIKey | QXOSWZXDSHMERY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide?
The IUPAC name of 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide (CID 91650678) is 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide.
What is the SMILES notation for 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide?
The canonical SMILES for 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide is Cc1nonc1NS(=O)(=O)c1cc2cc(Cl)ccc2s1.
What is the InChIKey of 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide?
The InChIKey is QXOSWZXDSHMERY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3O3S2/c1-6-11(14-18-13-6)15-20(16,17)10-5-7-4-8(12)2-3-9(7)19-10/h2-5H,1H3,(H,14,15).
What are the key properties of 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide?
5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide has a molecular weight of 329.79 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(4-methyl-1,2,5-oxadiazol-3-yl)-1-benzothiophene-2-sulfonamide is sourced from PubChem (CID 91650678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).