About N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide
N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide (PubChem CID 91650954) has the molecular formula C17H14FN3O3
and a molecular weight of 327.32 g/mol. Its IUPAC name is N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide.
Molecular Properties
| Compound Name | N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide |
| PubChem CID | 91650954 |
| Molecular Formula | C17H14FN3O3 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide |
| SMILES | CN(OCc1ccccc1)C(=O)C(=O)Nc1ccc(F)cc1C#N |
| InChI | InChI=1S/C17H14FN3O3/c1-21(24-11-12-5-3-2-4-6-12)17(23)16(22)20-15-8-7-14(18)9-13(15)10-19/h2-9H,11H2,1H3,(H,20,22) |
| InChIKey | KVJLDWTXZGNUSL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide?
The IUPAC name of N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide (CID 91650954) is N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide.
What is the SMILES notation for N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide?
The canonical SMILES for N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide is CN(OCc1ccccc1)C(=O)C(=O)Nc1ccc(F)cc1C#N.
What is the InChIKey of N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide?
The InChIKey is KVJLDWTXZGNUSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN3O3/c1-21(24-11-12-5-3-2-4-6-12)17(23)16(22)20-15-8-7-14(18)9-13(15)10-19/h2-9H,11H2,1H3,(H,20,22).
What are the key properties of N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide?
N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide has a molecular weight of 327.32 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyano-4-fluorophenyl)-N'-methyl-N'-phenylmethoxyoxamide is sourced from PubChem (CID 91650954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).