C11H13F4NO2 — CID 91651237
3-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyridin-2-one (PubChem CID 91651237) has the molecular formula C11H13F4NO2 and a molecular weight of 267.22 g/mol. Its IUPAC name is 3-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyridin-2-one.
| Compound Name | 3-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 91651237 |
| Molecular Formula | C11H13F4NO2 |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyridin-2-one |
| SMILES | Cc1cccn(CCOCC(F)(F)C(F)F)c1=O |
| InChI | InChI=1S/C11H13F4NO2/c1-8-3-2-4-16(9(8)17)5-6-18-7-11(14,15)10(12)13/h2-4,10H,5-7H2,1H3 |
| InChIKey | CRFAISAEFXYSIJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|