About N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide
N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide (PubChem CID 91651334) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide |
| PubChem CID | 91651334 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide |
| SMILES | COCCCN(C)C(=O)N1CCOC(C)(c2ccccc2)C1 |
| InChI | InChI=1S/C17H26N2O3/c1-17(15-8-5-4-6-9-15)14-19(11-13-22-17)16(20)18(2)10-7-12-21-3/h4-6,8-9H,7,10-14H2,1-3H3 |
| InChIKey | ADDXYHJFZAAPFH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide?
The IUPAC name of N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide (CID 91651334) is N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide.
What is the SMILES notation for N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide?
The canonical SMILES for N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide is COCCCN(C)C(=O)N1CCOC(C)(c2ccccc2)C1.
What is the InChIKey of N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide?
The InChIKey is ADDXYHJFZAAPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3/c1-17(15-8-5-4-6-9-15)14-19(11-13-22-17)16(20)18(2)10-7-12-21-3/h4-6,8-9H,7,10-14H2,1-3H3.
What are the key properties of N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide?
N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide has a molecular weight of 306.41 g/mol, XLogP of 2.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-N,2-dimethyl-2-phenylmorpholine-4-carboxamide is sourced from PubChem (CID 91651334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).