About N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide
N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide (PubChem CID 91651680) has the molecular formula C14H18FN3O3S
and a molecular weight of 327.38 g/mol. Its IUPAC name is N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide |
| PubChem CID | 91651680 |
| Molecular Formula | C14H18FN3O3S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide |
| SMILES | CCn1nc(C)c(NS(=O)(=O)c2ccc(F)c(OC)c2)c1C |
| InChI | InChI=1S/C14H18FN3O3S/c1-5-18-10(3)14(9(2)16-18)17-22(19,20)11-6-7-12(15)13(8-11)21-4/h6-8,17H,5H2,1-4H3 |
| InChIKey | LPMXVORIWADHFY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide?
The IUPAC name of N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide (CID 91651680) is N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide.
What is the SMILES notation for N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide?
The canonical SMILES for N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide is CCn1nc(C)c(NS(=O)(=O)c2ccc(F)c(OC)c2)c1C.
What is the InChIKey of N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide?
The InChIKey is LPMXVORIWADHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FN3O3S/c1-5-18-10(3)14(9(2)16-18)17-22(19,20)11-6-7-12(15)13(8-11)21-4/h6-8,17H,5H2,1-4H3.
What are the key properties of N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide?
N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide has a molecular weight of 327.38 g/mol, XLogP of 2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-4-fluoro-3-methoxybenzenesulfonamide is sourced from PubChem (CID 91651680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).