C19H23N3O3 — CID 91652114
(2-acetamido-1-phenylethyl) 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate (PubChem CID 91652114) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2-acetamido-1-phenylethyl) 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate.
| Compound Name | (2-acetamido-1-phenylethyl) 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 91652114 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (2-acetamido-1-phenylethyl) 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylate |
| SMILES | CC(=O)NCC(OC(=O)c1n[nH]c2c1CCCCC2)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O3/c1-13(23)20-12-17(14-8-4-2-5-9-14)25-19(24)18-15-10-6-3-7-11-16(15)21-22-18/h2,4-5,8-9,17H,3,6-7,10-12H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | ZBKFJPWKNUJOAP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |