About 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one
4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one (PubChem CID 91652420) has the molecular formula C12H10FN3O2S
and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 91652420 |
| Molecular Formula | C12H10FN3O2S |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CCNc2nc3cc(F)ccc3o2)cs1 |
| InChI | InChI=1S/C12H10FN3O2S/c13-7-1-2-10-9(5-7)16-11(18-10)14-4-3-8-6-19-12(17)15-8/h1-2,5-6H,3-4H2,(H,14,16)(H,15,17) |
| InChIKey | BVULJNKNOUOPMM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one (CID 91652420) is 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one is O=c1[nH]c(CCNc2nc3cc(F)ccc3o2)cs1.
What is the InChIKey of 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one?
The InChIKey is BVULJNKNOUOPMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FN3O2S/c13-7-1-2-10-9(5-7)16-11(18-10)14-4-3-8-6-19-12(17)15-8/h1-2,5-6H,3-4H2,(H,14,16)(H,15,17).
What are the key properties of 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one?
4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one has a molecular weight of 279.30 g/mol, XLogP of 2.37, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]ethyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 91652420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).