C12H19F4NO2 — CID 91652691
1-(2,3-dimethylpyrrolidin-1-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one (PubChem CID 91652691) has the molecular formula C12H19F4NO2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 1-(2,3-dimethylpyrrolidin-1-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one.
| Compound Name | 1-(2,3-dimethylpyrrolidin-1-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one |
|---|---|
| PubChem CID | 91652691 |
| Molecular Formula | C12H19F4NO2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-(2,3-dimethylpyrrolidin-1-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one |
| SMILES | CC1CCN(C(=O)CCOCC(F)(F)C(F)F)C1C |
| InChI | InChI=1S/C12H19F4NO2/c1-8-3-5-17(9(8)2)10(18)4-6-19-7-12(15,16)11(13)14/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | QSNNQUMSXXAJPQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|