C13H14F4N2O3 — CID 91652693
1-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one (PubChem CID 91652693) has the molecular formula C13H14F4N2O3 and a molecular weight of 322.26 g/mol. Its IUPAC name is 1-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one.
| Compound Name | 1-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one |
|---|---|
| PubChem CID | 91652693 |
| Molecular Formula | C13H14F4N2O3 |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)C(F)F)N1CCOc2ccncc21 |
| InChI | InChI=1S/C13H14F4N2O3/c14-12(15)13(16,17)8-21-5-2-11(20)19-4-6-22-10-1-3-18-7-9(10)19/h1,3,7,12H,2,4-6,8H2 |
| InChIKey | GHAWYYHOPJNMJF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|