About [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone
[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone (PubChem CID 91653040) has the molecular formula C16H18FN3O3
and a molecular weight of 319.34 g/mol. Its IUPAC name is [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone.
Molecular Properties
| Compound Name | [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone |
| PubChem CID | 91653040 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone |
| SMILES | CO[C@H]1CN(C(=O)c2ccn(-c3ccccc3F)n2)C[C@H]1OC |
| InChI | InChI=1S/C16H18FN3O3/c1-22-14-9-19(10-15(14)23-2)16(21)12-7-8-20(18-12)13-6-4-3-5-11(13)17/h3-8,14-15H,9-10H2,1-2H3/t14-,15+ |
| InChIKey | BVDAFZWKMQCHRT-GASCZTMLSA-N |
| XLogP | 1.50 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone?
The IUPAC name of [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone (CID 91653040) is [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone.
What is the SMILES notation for [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone?
The canonical SMILES for [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone is CO[C@H]1CN(C(=O)c2ccn(-c3ccccc3F)n2)C[C@H]1OC.
What is the InChIKey of [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone?
The InChIKey is BVDAFZWKMQCHRT-GASCZTMLSA-N. The full InChI is InChI=1S/C16H18FN3O3/c1-22-14-9-19(10-15(14)23-2)16(21)12-7-8-20(18-12)13-6-4-3-5-11(13)17/h3-8,14-15H,9-10H2,1-2H3/t14-,15+.
What are the key properties of [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone?
[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone has a molecular weight of 319.34 g/mol, XLogP of 1.50, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-[1-(2-fluorophenyl)pyrazol-3-yl]methanone is sourced from PubChem (CID 91653040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).