C14H18BrNO2 — CID 91653095
N-[(3-bromophenyl)methyl]-N-(2-hydroxyethyl)-2-methylcyclopropane-1-carboxamide (PubChem CID 91653095) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-(2-hydroxyethyl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-(2-hydroxyethyl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91653095 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-(2-hydroxyethyl)-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)N(CCO)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C14H18BrNO2/c1-10-7-13(10)14(18)16(5-6-17)9-11-3-2-4-12(15)8-11/h2-4,8,10,13,17H,5-7,9H2,1H3 |
| InChIKey | NQIPJFVMBNEMBS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |