About 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline
9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline (PubChem CID 91653372) has the molecular formula C13H11ClN4
and a molecular weight of 258.71 g/mol. Its IUPAC name is 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline.
Molecular Properties
| Compound Name | 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline |
| PubChem CID | 91653372 |
| Molecular Formula | C13H11ClN4 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline |
| SMILES | Clc1ccc2ncn3nc(C4CCC4)nc3c2c1 |
| InChI | InChI=1S/C13H11ClN4/c14-9-4-5-11-10(6-9)13-16-12(8-2-1-3-8)17-18(13)7-15-11/h4-8H,1-3H2 |
| InChIKey | VROZMVXGLWAYOB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline?
The IUPAC name of 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline (CID 91653372) is 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline.
What is the SMILES notation for 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline?
The canonical SMILES for 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline is Clc1ccc2ncn3nc(C4CCC4)nc3c2c1.
What is the InChIKey of 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline?
The InChIKey is VROZMVXGLWAYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN4/c14-9-4-5-11-10(6-9)13-16-12(8-2-1-3-8)17-18(13)7-15-11/h4-8H,1-3H2.
What are the key properties of 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline?
9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline has a molecular weight of 258.71 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-2-cyclobutyl-[1,2,4]triazolo[1,5-c]quinazoline is sourced from PubChem (CID 91653372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).