C16H14N2O3 — CID 91653718
4-[(1S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide (PubChem CID 91653718) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-[(1S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide.
| Compound Name | 4-[(1S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide |
|---|---|
| PubChem CID | 91653718 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[(1S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2C(=O)C3C(C2=O)[C@H]2C=C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C16H14N2O3/c17-14(19)8-3-5-11(6-4-8)18-15(20)12-9-1-2-10(7-9)13(12)16(18)21/h1-6,9-10,12-13H,7H2,(H2,17,19)/t9-,10+,12?,13? |
| InChIKey | XFKOPYRJAQQCRU-ASZHBFLOSA-N |
| XLogP | 1.10 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|