About 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid
2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid (PubChem CID 91654271) has the molecular formula C10H10F2O2
and a molecular weight of 200.18 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid.
Molecular Properties
| Compound Name | 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid |
| PubChem CID | 91654271 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid |
| SMILES | Cc1cccc(C)c1C(F)(F)C(=O)O |
| InChI | InChI=1S/C10H10F2O2/c1-6-4-3-5-7(2)8(6)10(11,12)9(13)14/h3-5H,1-2H3,(H,13,14) |
| InChIKey | XOOGIJSNARCZCA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid?
The IUPAC name of 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid (CID 91654271) is 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid.
What is the SMILES notation for 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid?
The canonical SMILES for 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid is Cc1cccc(C)c1C(F)(F)C(=O)O.
What is the InChIKey of 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid?
The InChIKey is XOOGIJSNARCZCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O2/c1-6-4-3-5-7(2)8(6)10(11,12)9(13)14/h3-5H,1-2H3,(H,13,14).
What are the key properties of 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid?
2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid has a molecular weight of 200.18 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylphenyl)-2,2-difluoroacetic acid is sourced from PubChem (CID 91654271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).