About methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride
methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride (PubChem CID 91654387) has the molecular formula C6H8ClNO2S
and a molecular weight of 193.66 g/mol. Its IUPAC name is methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride |
| PubChem CID | 91654387 |
| Molecular Formula | C6H8ClNO2S |
| Molecular Weight | 193.66 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride |
| SMILES | COC(=O)Cc1nccs1.Cl |
| InChI | InChI=1S/C6H7NO2S.ClH/c1-9-6(8)4-5-7-2-3-10-5;/h2-3H,4H2,1H3;1H |
| InChIKey | JVKQPGDKNNATEM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.66 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride?
The IUPAC name of methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride (CID 91654387) is methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride.
What is the SMILES notation for methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride?
The canonical SMILES for methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride is COC(=O)Cc1nccs1.Cl.
What is the InChIKey of methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride?
The InChIKey is JVKQPGDKNNATEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S.ClH/c1-9-6(8)4-5-7-2-3-10-5;/h2-3H,4H2,1H3;1H.
What are the key properties of methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride?
methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride has a molecular weight of 193.66 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,3-thiazol-2-yl)acetate;hydrochloride is sourced from PubChem (CID 91654387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).