C7H14ClN — CID 91654388
4,5-dimethyl-1,2,3,6-tetrahydropyridine;hydrochloride (PubChem CID 91654388) has the molecular formula C7H14ClN and a molecular weight of 147.65 g/mol. Its IUPAC name is 4,5-dimethyl-1,2,3,6-tetrahydropyridine;hydrochloride.
| Compound Name | 4,5-dimethyl-1,2,3,6-tetrahydropyridine;hydrochloride |
|---|---|
| PubChem CID | 91654388 |
| Molecular Formula | C7H14ClN |
| Molecular Weight | 147.65 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 4,5-dimethyl-1,2,3,6-tetrahydropyridine;hydrochloride |
| SMILES | CC1=C(C)CNCC1.Cl |
| InChI | InChI=1S/C7H13N.ClH/c1-6-3-4-8-5-7(6)2;/h8H,3-5H2,1-2H3;1H |
| InChIKey | WYIXJQCZUIONHJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.65 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|